About 3-hydroxy-N,N-dimethylnonanamide
3-hydroxy-N,N-dimethylnonanamide (PubChem CID 551805) has the molecular formula C11H23NO2
and a molecular weight of 201.31 g/mol. Its IUPAC name is 3-hydroxy-N,N-dimethylnonanamide.
Molecular Properties
| Compound Name | 3-hydroxy-N,N-dimethylnonanamide |
| PubChem CID | 551805 |
| Molecular Formula | C11H23NO2 |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.17 |
| IUPAC Name | 3-hydroxy-N,N-dimethylnonanamide |
| SMILES | CCCCCCC(O)CC(=O)N(C)C |
| InChI | InChI=1S/C11H23NO2/c1-4-5-6-7-8-10(13)9-11(14)12(2)3/h10,13H,4-9H2,1-3H3 |
| InChIKey | RNJOHBBLTUAYAA-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-hydroxy-N,N-dimethylnonanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxy-N,N-dimethylnonanamide?
The IUPAC name of 3-hydroxy-N,N-dimethylnonanamide (CID 551805) is 3-hydroxy-N,N-dimethylnonanamide.
What is the SMILES notation for 3-hydroxy-N,N-dimethylnonanamide?
The canonical SMILES for 3-hydroxy-N,N-dimethylnonanamide is CCCCCCC(O)CC(=O)N(C)C.
What is the InChIKey of 3-hydroxy-N,N-dimethylnonanamide?
The InChIKey is RNJOHBBLTUAYAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23NO2/c1-4-5-6-7-8-10(13)9-11(14)12(2)3/h10,13H,4-9H2,1-3H3.
What are the key properties of 3-hydroxy-N,N-dimethylnonanamide?
3-hydroxy-N,N-dimethylnonanamide has a molecular weight of 201.31 g/mol, XLogP of 1.80, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxy-N,N-dimethylnonanamide is sourced from PubChem (CID 551805), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).