C13H13ClN2OS2 — CID 55181570
4-chloro-2-[2-(4-methyl-1,3-thiazol-5-yl)ethoxy]benzenecarbothioamide (PubChem CID 55181570) has the molecular formula C13H13ClN2OS2 and a molecular weight of 312.85 g/mol. Its IUPAC name is 4-chloro-2-[2-(4-methyl-1,3-thiazol-5-yl)ethoxy]benzenecarbothioamide.
| Compound Name | 4-chloro-2-[2-(4-methyl-1,3-thiazol-5-yl)ethoxy]benzenecarbothioamide |
|---|---|
| PubChem CID | 55181570 |
| Molecular Formula | C13H13ClN2OS2 |
| Molecular Weight | 312.85 g/mol |
| Exact Mass | 312.02 |
| IUPAC Name | 4-chloro-2-[2-(4-methyl-1,3-thiazol-5-yl)ethoxy]benzenecarbothioamide |
| SMILES | Cc1ncsc1CCOc1cc(Cl)ccc1C(N)=S |
| InChI | InChI=1S/C13H13ClN2OS2/c1-8-12(19-7-16-8)4-5-17-11-6-9(14)2-3-10(11)13(15)18/h2-3,6-7H,4-5H2,1H3,(H2,15,18) |
| InChIKey | NBJKHAQHWUHXBE-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.85 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|