C14H13ClFN — CID 55181591
1-(3-chloro-4-fluorophenyl)-N-methyl-1-phenylmethanamine (PubChem CID 55181591) has the molecular formula C14H13ClFN and a molecular weight of 249.72 g/mol. Its IUPAC name is 1-(3-chloro-4-fluorophenyl)-N-methyl-1-phenylmethanamine.
| Compound Name | 1-(3-chloro-4-fluorophenyl)-N-methyl-1-phenylmethanamine |
|---|---|
| PubChem CID | 55181591 |
| Molecular Formula | C14H13ClFN |
| Molecular Weight | 249.72 g/mol |
| Exact Mass | 249.07 |
| IUPAC Name | 1-(3-chloro-4-fluorophenyl)-N-methyl-1-phenylmethanamine |
| SMILES | CNC(c1ccccc1)c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C14H13ClFN/c1-17-14(10-5-3-2-4-6-10)11-7-8-13(16)12(15)9-11/h2-9,14,17H,1H3 |
| InChIKey | JPIVXVWWYOFAEM-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.72 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |