About 3-fluoro-4-(1,3-thiazol-2-ylsulfanylmethyl)benzoic acid
3-fluoro-4-(1,3-thiazol-2-ylsulfanylmethyl)benzoic acid (PubChem CID 55182065) has the molecular formula C11H8FNO2S2
and a molecular weight of 269.32 g/mol. Its IUPAC name is 3-fluoro-4-(1,3-thiazol-2-ylsulfanylmethyl)benzoic acid.
Molecular Properties
| Compound Name | 3-fluoro-4-(1,3-thiazol-2-ylsulfanylmethyl)benzoic acid |
| PubChem CID | 55182065 |
| Molecular Formula | C11H8FNO2S2 |
| Molecular Weight | 269.32 g/mol |
| Exact Mass | 269.00 |
| IUPAC Name | 3-fluoro-4-(1,3-thiazol-2-ylsulfanylmethyl)benzoic acid |
| SMILES | O=C(O)c1ccc(CSc2nccs2)c(F)c1 |
| InChI | InChI=1S/C11H8FNO2S2/c12-9-5-7(10(14)15)1-2-8(9)6-17-11-13-3-4-16-11/h1-5H,6H2,(H,14,15) |
| InChIKey | XTVAYCZVXKTJFO-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.32 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'} |
|---|
Analyze 3-fluoro-4-(1,3-thiazol-2-ylsulfanylmethyl)benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-4-(1,3-thiazol-2-ylsulfanylmethyl)benzoic acid?
The IUPAC name of 3-fluoro-4-(1,3-thiazol-2-ylsulfanylmethyl)benzoic acid (CID 55182065) is 3-fluoro-4-(1,3-thiazol-2-ylsulfanylmethyl)benzoic acid.
What is the SMILES notation for 3-fluoro-4-(1,3-thiazol-2-ylsulfanylmethyl)benzoic acid?
The canonical SMILES for 3-fluoro-4-(1,3-thiazol-2-ylsulfanylmethyl)benzoic acid is O=C(O)c1ccc(CSc2nccs2)c(F)c1.
What is the InChIKey of 3-fluoro-4-(1,3-thiazol-2-ylsulfanylmethyl)benzoic acid?
The InChIKey is XTVAYCZVXKTJFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8FNO2S2/c12-9-5-7(10(14)15)1-2-8(9)6-17-11-13-3-4-16-11/h1-5H,6H2,(H,14,15).
What are the key properties of 3-fluoro-4-(1,3-thiazol-2-ylsulfanylmethyl)benzoic acid?
3-fluoro-4-(1,3-thiazol-2-ylsulfanylmethyl)benzoic acid has a molecular weight of 269.32 g/mol, XLogP of 3.27, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-4-(1,3-thiazol-2-ylsulfanylmethyl)benzoic acid is sourced from PubChem (CID 55182065), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).