C12H12Cl2O2S — CID 55182248
2-(2,5-dichlorophenyl)sulfanylcyclopentane-1-carboxylic acid (PubChem CID 55182248) has the molecular formula C12H12Cl2O2S and a molecular weight of 291.20 g/mol. Its IUPAC name is 2-(2,5-dichlorophenyl)sulfanylcyclopentane-1-carboxylic acid.
| Compound Name | 2-(2,5-dichlorophenyl)sulfanylcyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 55182248 |
| Molecular Formula | C12H12Cl2O2S |
| Molecular Weight | 291.20 g/mol |
| Exact Mass | 289.99 |
| IUPAC Name | 2-(2,5-dichlorophenyl)sulfanylcyclopentane-1-carboxylic acid |
| SMILES | O=C(O)C1CCCC1Sc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C12H12Cl2O2S/c13-7-4-5-9(14)11(6-7)17-10-3-1-2-8(10)12(15)16/h4-6,8,10H,1-3H2,(H,15,16) |
| InChIKey | ZAOYMAZBQYQZRY-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.20 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |