About 6-(4-hydroxy-1,1-dioxothiolan-3-yl)oxy-1-benzofuran-3-one
6-(4-hydroxy-1,1-dioxothiolan-3-yl)oxy-1-benzofuran-3-one (PubChem CID 55182420) has the molecular formula C12H12O6S
and a molecular weight of 284.29 g/mol. Its IUPAC name is 6-(4-hydroxy-1,1-dioxothiolan-3-yl)oxy-1-benzofuran-3-one.
Molecular Properties
| Compound Name | 6-(4-hydroxy-1,1-dioxothiolan-3-yl)oxy-1-benzofuran-3-one |
| PubChem CID | 55182420 |
| Molecular Formula | C12H12O6S |
| Molecular Weight | 284.29 g/mol |
| Exact Mass | 284.04 |
| IUPAC Name | 6-(4-hydroxy-1,1-dioxothiolan-3-yl)oxy-1-benzofuran-3-one |
| SMILES | O=C1COc2cc(OC3CS(=O)(=O)CC3O)ccc21 |
| InChI | InChI=1S/C12H12O6S/c13-9-4-17-11-3-7(1-2-8(9)11)18-12-6-19(15,16)5-10(12)14/h1-3,10,12,14H,4-6H2 |
| InChIKey | RCYFHJNGFMACRF-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.29 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 6-(4-hydroxy-1,1-dioxothiolan-3-yl)oxy-1-benzofuran-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(4-hydroxy-1,1-dioxothiolan-3-yl)oxy-1-benzofuran-3-one?
The IUPAC name of 6-(4-hydroxy-1,1-dioxothiolan-3-yl)oxy-1-benzofuran-3-one (CID 55182420) is 6-(4-hydroxy-1,1-dioxothiolan-3-yl)oxy-1-benzofuran-3-one.
What is the SMILES notation for 6-(4-hydroxy-1,1-dioxothiolan-3-yl)oxy-1-benzofuran-3-one?
The canonical SMILES for 6-(4-hydroxy-1,1-dioxothiolan-3-yl)oxy-1-benzofuran-3-one is O=C1COc2cc(OC3CS(=O)(=O)CC3O)ccc21.
What is the InChIKey of 6-(4-hydroxy-1,1-dioxothiolan-3-yl)oxy-1-benzofuran-3-one?
The InChIKey is RCYFHJNGFMACRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12O6S/c13-9-4-17-11-3-7(1-2-8(9)11)18-12-6-19(15,16)5-10(12)14/h1-3,10,12,14H,4-6H2.
What are the key properties of 6-(4-hydroxy-1,1-dioxothiolan-3-yl)oxy-1-benzofuran-3-one?
6-(4-hydroxy-1,1-dioxothiolan-3-yl)oxy-1-benzofuran-3-one has a molecular weight of 284.29 g/mol, XLogP of -0.20, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(4-hydroxy-1,1-dioxothiolan-3-yl)oxy-1-benzofuran-3-one is sourced from PubChem (CID 55182420), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).