C10H7ClFN3O3S — CID 55182484
3-fluoro-4-(1H-pyrazole-4-carbonylamino)benzenesulfonyl chloride (PubChem CID 55182484) has the molecular formula C10H7ClFN3O3S and a molecular weight of 303.70 g/mol. Its IUPAC name is 3-fluoro-4-(1H-pyrazole-4-carbonylamino)benzenesulfonyl chloride.
| Compound Name | 3-fluoro-4-(1H-pyrazole-4-carbonylamino)benzenesulfonyl chloride |
|---|---|
| PubChem CID | 55182484 |
| Molecular Formula | C10H7ClFN3O3S |
| Molecular Weight | 303.70 g/mol |
| Exact Mass | 302.99 |
| IUPAC Name | 3-fluoro-4-(1H-pyrazole-4-carbonylamino)benzenesulfonyl chloride |
| SMILES | O=C(Nc1ccc(S(=O)(=O)Cl)cc1F)c1cn[nH]c1 |
| InChI | InChI=1S/C10H7ClFN3O3S/c11-19(17,18)7-1-2-9(8(12)3-7)15-10(16)6-4-13-14-5-6/h1-5H,(H,13,14)(H,15,16) |
| InChIKey | XXSNBCVWTTYRRN-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 91.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.70 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |