C14H18ClNO2 — CID 55183162
(4-chloropiperidin-1-yl)-(3-methoxy-4-methylphenyl)methanone (PubChem CID 55183162) has the molecular formula C14H18ClNO2 and a molecular weight of 267.76 g/mol. Its IUPAC name is (4-chloropiperidin-1-yl)-(3-methoxy-4-methylphenyl)methanone.
| Compound Name | (4-chloropiperidin-1-yl)-(3-methoxy-4-methylphenyl)methanone |
|---|---|
| PubChem CID | 55183162 |
| Molecular Formula | C14H18ClNO2 |
| Molecular Weight | 267.76 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | (4-chloropiperidin-1-yl)-(3-methoxy-4-methylphenyl)methanone |
| SMILES | COc1cc(C(=O)N2CCC(Cl)CC2)ccc1C |
| InChI | InChI=1S/C14H18ClNO2/c1-10-3-4-11(9-13(10)18-2)14(17)16-7-5-12(15)6-8-16/h3-4,9,12H,5-8H2,1-2H3 |
| InChIKey | PXYLEBDLXWLTHB-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.76 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|