C14H12Cl2FNO — CID 55183896
(1R)-1-[4-(3,4-dichlorophenoxy)-3-fluorophenyl]ethanamine (PubChem CID 55183896) has the molecular formula C14H12Cl2FNO and a molecular weight of 300.16 g/mol. Its IUPAC name is (1R)-1-[4-(3,4-dichlorophenoxy)-3-fluorophenyl]ethanamine.
| Compound Name | (1R)-1-[4-(3,4-dichlorophenoxy)-3-fluorophenyl]ethanamine |
|---|---|
| PubChem CID | 55183896 |
| Molecular Formula | C14H12Cl2FNO |
| Molecular Weight | 300.16 g/mol |
| Exact Mass | 299.03 |
| IUPAC Name | (1R)-1-[4-(3,4-dichlorophenoxy)-3-fluorophenyl]ethanamine |
| SMILES | C[C@@H](N)c1ccc(Oc2ccc(Cl)c(Cl)c2)c(F)c1 |
| InChI | InChI=1S/C14H12Cl2FNO/c1-8(18)9-2-5-14(13(17)6-9)19-10-3-4-11(15)12(16)7-10/h2-8H,18H2,1H3/t8-/m1/s1 |
| InChIKey | DPCFBKDIDVFOSF-MRVPVSSYSA-N |
| XLogP | 4.94 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.16 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |