C11H22N2O2 — CID 551840
2,2-diethyl-N,N,N',N'-tetramethylpropanediamide (PubChem CID 551840) has the molecular formula C11H22N2O2 and a molecular weight of 214.31 g/mol. Its IUPAC name is 2,2-diethyl-N,N,N',N'-tetramethylpropanediamide.
| Compound Name | 2,2-diethyl-N,N,N',N'-tetramethylpropanediamide |
|---|---|
| PubChem CID | 551840 |
| Molecular Formula | C11H22N2O2 |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.17 |
| IUPAC Name | 2,2-diethyl-N,N,N',N'-tetramethylpropanediamide |
| SMILES | CCC(CC)(C(=O)N(C)C)C(=O)N(C)C |
| InChI | InChI=1S/C11H22N2O2/c1-7-11(8-2,9(14)12(3)4)10(15)13(5)6/h7-8H2,1-6H3 |
| InChIKey | SZZARXOCFKNPBU-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|