About 5-[(4-oxothieno[2,3-d]pyrimidin-3-yl)methyl]thiophene-2-carboxylic acid
5-[(4-oxothieno[2,3-d]pyrimidin-3-yl)methyl]thiophene-2-carboxylic acid (PubChem CID 55184366) has the molecular formula C12H8N2O3S2
and a molecular weight of 292.34 g/mol. Its IUPAC name is 5-[(4-oxothieno[2,3-d]pyrimidin-3-yl)methyl]thiophene-2-carboxylic acid.
Molecular Properties
| Compound Name | 5-[(4-oxothieno[2,3-d]pyrimidin-3-yl)methyl]thiophene-2-carboxylic acid |
| PubChem CID | 55184366 |
| Molecular Formula | C12H8N2O3S2 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.00 |
| IUPAC Name | 5-[(4-oxothieno[2,3-d]pyrimidin-3-yl)methyl]thiophene-2-carboxylic acid |
| SMILES | O=C(O)c1ccc(Cn2cnc3sccc3c2=O)s1 |
| InChI | InChI=1S/C12H8N2O3S2/c15-11-8-3-4-18-10(8)13-6-14(11)5-7-1-2-9(19-7)12(16)17/h1-4,6H,5H2,(H,16,17) |
| InChIKey | ZVXQEQFGAYLNIT-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-[(4-oxothieno[2,3-d]pyrimidin-3-yl)methyl]thiophene-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(4-oxothieno[2,3-d]pyrimidin-3-yl)methyl]thiophene-2-carboxylic acid?
The IUPAC name of 5-[(4-oxothieno[2,3-d]pyrimidin-3-yl)methyl]thiophene-2-carboxylic acid (CID 55184366) is 5-[(4-oxothieno[2,3-d]pyrimidin-3-yl)methyl]thiophene-2-carboxylic acid.
What is the SMILES notation for 5-[(4-oxothieno[2,3-d]pyrimidin-3-yl)methyl]thiophene-2-carboxylic acid?
The canonical SMILES for 5-[(4-oxothieno[2,3-d]pyrimidin-3-yl)methyl]thiophene-2-carboxylic acid is O=C(O)c1ccc(Cn2cnc3sccc3c2=O)s1.
What is the InChIKey of 5-[(4-oxothieno[2,3-d]pyrimidin-3-yl)methyl]thiophene-2-carboxylic acid?
The InChIKey is ZVXQEQFGAYLNIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8N2O3S2/c15-11-8-3-4-18-10(8)13-6-14(11)5-7-1-2-9(19-7)12(16)17/h1-4,6H,5H2,(H,16,17).
What are the key properties of 5-[(4-oxothieno[2,3-d]pyrimidin-3-yl)methyl]thiophene-2-carboxylic acid?
5-[(4-oxothieno[2,3-d]pyrimidin-3-yl)methyl]thiophene-2-carboxylic acid has a molecular weight of 292.34 g/mol, XLogP of 2.27, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(4-oxothieno[2,3-d]pyrimidin-3-yl)methyl]thiophene-2-carboxylic acid is sourced from PubChem (CID 55184366), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).