C14H14ClN3O — CID 55185515
(3-chloropiperidin-1-yl)-quinoxalin-6-ylmethanone (PubChem CID 55185515) has the molecular formula C14H14ClN3O and a molecular weight of 275.74 g/mol. Its IUPAC name is (3-chloropiperidin-1-yl)-quinoxalin-6-ylmethanone.
| Compound Name | (3-chloropiperidin-1-yl)-quinoxalin-6-ylmethanone |
|---|---|
| PubChem CID | 55185515 |
| Molecular Formula | C14H14ClN3O |
| Molecular Weight | 275.74 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | (3-chloropiperidin-1-yl)-quinoxalin-6-ylmethanone |
| SMILES | O=C(c1ccc2nccnc2c1)N1CCCC(Cl)C1 |
| InChI | InChI=1S/C14H14ClN3O/c15-11-2-1-7-18(9-11)14(19)10-3-4-12-13(8-10)17-6-5-16-12/h3-6,8,11H,1-2,7,9H2 |
| InChIKey | WSTIJAYVGSASFA-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.74 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|