C10H9NS — CID 551875
5-methyl-2-phenyl-1,3-thiazole (PubChem CID 551875) has the molecular formula C10H9NS and a molecular weight of 175.26 g/mol. Its IUPAC name is 5-methyl-2-phenyl-1,3-thiazole.
| Compound Name | 5-methyl-2-phenyl-1,3-thiazole |
|---|---|
| PubChem CID | 551875 |
| Molecular Formula | C10H9NS |
| Molecular Weight | 175.26 g/mol |
| Exact Mass | 175.05 |
| IUPAC Name | 5-methyl-2-phenyl-1,3-thiazole |
| SMILES | Cc1cnc(-c2ccccc2)s1 |
| InChI | InChI=1S/C10H9NS/c1-8-7-11-10(12-8)9-5-3-2-4-6-9/h2-7H,1H3 |
| InChIKey | BRUABIDQGMULTN-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.26 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |