About 4-methyl-2-phenyl-1,3-thiazole
4-methyl-2-phenyl-1,3-thiazole (PubChem CID 551876) has the molecular formula C10H9NS
and a molecular weight of 175.26 g/mol. Its IUPAC name is 4-methyl-2-phenyl-1,3-thiazole.
Molecular Properties
| Compound Name | 4-methyl-2-phenyl-1,3-thiazole |
| PubChem CID | 551876 |
| Molecular Formula | C10H9NS |
| Molecular Weight | 175.26 g/mol |
| Exact Mass | 175.05 |
| IUPAC Name | 4-methyl-2-phenyl-1,3-thiazole |
| SMILES | Cc1csc(-c2ccccc2)n1 |
| InChI | InChI=1S/C10H9NS/c1-8-7-12-10(11-8)9-5-3-2-4-6-9/h2-7H,1H3 |
| InChIKey | IPOHWQDCODUHTD-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.26 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-methyl-2-phenyl-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-2-phenyl-1,3-thiazole?
The IUPAC name of 4-methyl-2-phenyl-1,3-thiazole (CID 551876) is 4-methyl-2-phenyl-1,3-thiazole.
What is the SMILES notation for 4-methyl-2-phenyl-1,3-thiazole?
The canonical SMILES for 4-methyl-2-phenyl-1,3-thiazole is Cc1csc(-c2ccccc2)n1.
What is the InChIKey of 4-methyl-2-phenyl-1,3-thiazole?
The InChIKey is IPOHWQDCODUHTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9NS/c1-8-7-12-10(11-8)9-5-3-2-4-6-9/h2-7H,1H3.
What are the key properties of 4-methyl-2-phenyl-1,3-thiazole?
4-methyl-2-phenyl-1,3-thiazole has a molecular weight of 175.26 g/mol, XLogP of 3.12, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-2-phenyl-1,3-thiazole is sourced from PubChem (CID 551876), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).