C14H12ClF2NO — CID 55187703
9-chloro-7-(difluoromethoxy)-1,2,3,4-tetrahydroacridine (PubChem CID 55187703) has the molecular formula C14H12ClF2NO and a molecular weight of 283.70 g/mol. Its IUPAC name is 9-chloro-7-(difluoromethoxy)-1,2,3,4-tetrahydroacridine.
| Compound Name | 9-chloro-7-(difluoromethoxy)-1,2,3,4-tetrahydroacridine |
|---|---|
| PubChem CID | 55187703 |
| Molecular Formula | C14H12ClF2NO |
| Molecular Weight | 283.70 g/mol |
| Exact Mass | 283.06 |
| IUPAC Name | 9-chloro-7-(difluoromethoxy)-1,2,3,4-tetrahydroacridine |
| SMILES | FC(F)Oc1ccc2nc3c(c(Cl)c2c1)CCCC3 |
| InChI | InChI=1S/C14H12ClF2NO/c15-13-9-3-1-2-4-11(9)18-12-6-5-8(7-10(12)13)19-14(16)17/h5-7,14H,1-4H2 |
| InChIKey | TXCAYTWEXLYICH-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.70 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |