C14H16ClNO3 — CID 55188169
(3-chloropiperidin-1-yl)-(2,3-dihydro-1,4-benzodioxin-5-yl)methanone (PubChem CID 55188169) has the molecular formula C14H16ClNO3 and a molecular weight of 281.74 g/mol. Its IUPAC name is (3-chloropiperidin-1-yl)-(2,3-dihydro-1,4-benzodioxin-5-yl)methanone.
| Compound Name | (3-chloropiperidin-1-yl)-(2,3-dihydro-1,4-benzodioxin-5-yl)methanone |
|---|---|
| PubChem CID | 55188169 |
| Molecular Formula | C14H16ClNO3 |
| Molecular Weight | 281.74 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | (3-chloropiperidin-1-yl)-(2,3-dihydro-1,4-benzodioxin-5-yl)methanone |
| SMILES | O=C(c1cccc2c1OCCO2)N1CCCC(Cl)C1 |
| InChI | InChI=1S/C14H16ClNO3/c15-10-3-2-6-16(9-10)14(17)11-4-1-5-12-13(11)19-8-7-18-12/h1,4-5,10H,2-3,6-9H2 |
| InChIKey | ZFKACFWBLDXBBZ-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.74 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|