C15H16ClNO2 — CID 55188193
1-benzofuran-2-yl-[4-(chloromethyl)piperidin-1-yl]methanone (PubChem CID 55188193) has the molecular formula C15H16ClNO2 and a molecular weight of 277.75 g/mol. Its IUPAC name is 1-benzofuran-2-yl-[4-(chloromethyl)piperidin-1-yl]methanone.
| Compound Name | 1-benzofuran-2-yl-[4-(chloromethyl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 55188193 |
| Molecular Formula | C15H16ClNO2 |
| Molecular Weight | 277.75 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | 1-benzofuran-2-yl-[4-(chloromethyl)piperidin-1-yl]methanone |
| SMILES | O=C(c1cc2ccccc2o1)N1CCC(CCl)CC1 |
| InChI | InChI=1S/C15H16ClNO2/c16-10-11-5-7-17(8-6-11)15(18)14-9-12-3-1-2-4-13(12)19-14/h1-4,9,11H,5-8,10H2 |
| InChIKey | AIHPEOLQXZZPEM-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.75 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|