About N-(3-chloropropyl)-1,1-dioxo-N-propan-2-ylthiane-4-sulfonamide
N-(3-chloropropyl)-1,1-dioxo-N-propan-2-ylthiane-4-sulfonamide (PubChem CID 55188398) has the molecular formula C11H22ClNO4S2
and a molecular weight of 331.89 g/mol. Its IUPAC name is N-(3-chloropropyl)-1,1-dioxo-N-propan-2-ylthiane-4-sulfonamide.
Molecular Properties
| Compound Name | N-(3-chloropropyl)-1,1-dioxo-N-propan-2-ylthiane-4-sulfonamide |
| PubChem CID | 55188398 |
| Molecular Formula | C11H22ClNO4S2 |
| Molecular Weight | 331.89 g/mol |
| Exact Mass | 331.07 |
| IUPAC Name | N-(3-chloropropyl)-1,1-dioxo-N-propan-2-ylthiane-4-sulfonamide |
| SMILES | CC(C)N(CCCCl)S(=O)(=O)C1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C11H22ClNO4S2/c1-10(2)13(7-3-6-12)19(16,17)11-4-8-18(14,15)9-5-11/h10-11H,3-9H2,1-2H3 |
| InChIKey | PJOKVKABMSHNEZ-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.89 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze N-(3-chloropropyl)-1,1-dioxo-N-propan-2-ylthiane-4-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-chloropropyl)-1,1-dioxo-N-propan-2-ylthiane-4-sulfonamide?
The IUPAC name of N-(3-chloropropyl)-1,1-dioxo-N-propan-2-ylthiane-4-sulfonamide (CID 55188398) is N-(3-chloropropyl)-1,1-dioxo-N-propan-2-ylthiane-4-sulfonamide.
What is the SMILES notation for N-(3-chloropropyl)-1,1-dioxo-N-propan-2-ylthiane-4-sulfonamide?
The canonical SMILES for N-(3-chloropropyl)-1,1-dioxo-N-propan-2-ylthiane-4-sulfonamide is CC(C)N(CCCCl)S(=O)(=O)C1CCS(=O)(=O)CC1.
What is the InChIKey of N-(3-chloropropyl)-1,1-dioxo-N-propan-2-ylthiane-4-sulfonamide?
The InChIKey is PJOKVKABMSHNEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22ClNO4S2/c1-10(2)13(7-3-6-12)19(16,17)11-4-8-18(14,15)9-5-11/h10-11H,3-9H2,1-2H3.
What are the key properties of N-(3-chloropropyl)-1,1-dioxo-N-propan-2-ylthiane-4-sulfonamide?
N-(3-chloropropyl)-1,1-dioxo-N-propan-2-ylthiane-4-sulfonamide has a molecular weight of 331.89 g/mol, XLogP of 1.23, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-chloropropyl)-1,1-dioxo-N-propan-2-ylthiane-4-sulfonamide is sourced from PubChem (CID 55188398), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).