About N-[4-[(1R)-1-aminoethyl]phenyl]-N,2,4-trimethylaniline
N-[4-[(1R)-1-aminoethyl]phenyl]-N,2,4-trimethylaniline (PubChem CID 55190482) has the molecular formula C17H22N2
and a molecular weight of 254.38 g/mol. Its IUPAC name is N-[4-[(1R)-1-aminoethyl]phenyl]-N,2,4-trimethylaniline.
Molecular Properties
| Compound Name | N-[4-[(1R)-1-aminoethyl]phenyl]-N,2,4-trimethylaniline |
| PubChem CID | 55190482 |
| Molecular Formula | C17H22N2 |
| Molecular Weight | 254.38 g/mol |
| Exact Mass | 254.18 |
| IUPAC Name | N-[4-[(1R)-1-aminoethyl]phenyl]-N,2,4-trimethylaniline |
| SMILES | Cc1ccc(N(C)c2ccc([C@@H](C)N)cc2)c(C)c1 |
| InChI | InChI=1S/C17H22N2/c1-12-5-10-17(13(2)11-12)19(4)16-8-6-15(7-9-16)14(3)18/h5-11,14H,18H2,1-4H3/t14-/m1/s1 |
| InChIKey | DWDKHSSDRYLECI-CQSZACIVSA-N |
| XLogP | 4.09 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.38 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[4-[(1R)-1-aminoethyl]phenyl]-N,2,4-trimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-[(1R)-1-aminoethyl]phenyl]-N,2,4-trimethylaniline?
The IUPAC name of N-[4-[(1R)-1-aminoethyl]phenyl]-N,2,4-trimethylaniline (CID 55190482) is N-[4-[(1R)-1-aminoethyl]phenyl]-N,2,4-trimethylaniline.
What is the SMILES notation for N-[4-[(1R)-1-aminoethyl]phenyl]-N,2,4-trimethylaniline?
The canonical SMILES for N-[4-[(1R)-1-aminoethyl]phenyl]-N,2,4-trimethylaniline is Cc1ccc(N(C)c2ccc([C@@H](C)N)cc2)c(C)c1.
What is the InChIKey of N-[4-[(1R)-1-aminoethyl]phenyl]-N,2,4-trimethylaniline?
The InChIKey is DWDKHSSDRYLECI-CQSZACIVSA-N. The full InChI is InChI=1S/C17H22N2/c1-12-5-10-17(13(2)11-12)19(4)16-8-6-15(7-9-16)14(3)18/h5-11,14H,18H2,1-4H3/t14-/m1/s1.
What are the key properties of N-[4-[(1R)-1-aminoethyl]phenyl]-N,2,4-trimethylaniline?
N-[4-[(1R)-1-aminoethyl]phenyl]-N,2,4-trimethylaniline has a molecular weight of 254.38 g/mol, XLogP of 4.09, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-[(1R)-1-aminoethyl]phenyl]-N,2,4-trimethylaniline is sourced from PubChem (CID 55190482), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).