C12H16N2O4 — CID 55190570
N-carbamoyl-2-[4-[(1S)-1-hydroxyethyl]phenoxy]propanamide (PubChem CID 55190570) has the molecular formula C12H16N2O4 and a molecular weight of 252.27 g/mol. Its IUPAC name is N-carbamoyl-2-[4-[(1S)-1-hydroxyethyl]phenoxy]propanamide.
| Compound Name | N-carbamoyl-2-[4-[(1S)-1-hydroxyethyl]phenoxy]propanamide |
|---|---|
| PubChem CID | 55190570 |
| Molecular Formula | C12H16N2O4 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.11 |
| IUPAC Name | N-carbamoyl-2-[4-[(1S)-1-hydroxyethyl]phenoxy]propanamide |
| SMILES | CC(Oc1ccc([C@H](C)O)cc1)C(=O)NC(N)=O |
| InChI | InChI=1S/C12H16N2O4/c1-7(15)9-3-5-10(6-4-9)18-8(2)11(16)14-12(13)17/h3-8,15H,1-2H3,(H3,13,14,16,17)/t7-,8?/m0/s1 |
| InChIKey | ZXOJJWIZTHDJPD-JAMMHHFISA-N |
| XLogP | 0.70 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |