About Gepirone
Gepirone (PubChem CID 55191) has the molecular formula C19H29N5O2
and a molecular weight of 359.50 g/mol. Its IUPAC name is 4,4-dimethyl-1-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]piperidine-2,6-dione.
Molecular Properties
| Compound Name | Gepirone |
| PubChem CID | 55191 |
| Molecular Formula | C19H29N5O2 |
| Molecular Weight | 359.50 g/mol |
| Exact Mass | 359.23 |
| IUPAC Name | 4,4-dimethyl-1-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]piperidine-2,6-dione |
| SMILES | CC1(CC(=O)N(C(=O)C1)CCCCN2CCN(CC2)C3=NC=CC=N3)C |
| InChI | InChI=1S/C19H29N5O2/c1-19(2)14-16(25)24(17(26)15-19)9-4-3-8-22-10-12-23(13-11-22)18-20-6-5-7-21-18/h5-7H,3-4,8-15H2,1-2H3 |
| InChIKey | QOIGKGMMAGJZNZ-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 69.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | 476 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.50 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze Gepirone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Gepirone?
The IUPAC name of Gepirone (CID 55191) is 4,4-dimethyl-1-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]piperidine-2,6-dione.
What is the SMILES notation for Gepirone?
The canonical SMILES for Gepirone is CC1(CC(=O)N(C(=O)C1)CCCCN2CCN(CC2)C3=NC=CC=N3)C.
What is the InChIKey of Gepirone?
The InChIKey is QOIGKGMMAGJZNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H29N5O2/c1-19(2)14-16(25)24(17(26)15-19)9-4-3-8-22-10-12-23(13-11-22)18-20-6-5-7-21-18/h5-7H,3-4,8-15H2,1-2H3.
What are the key properties of Gepirone?
Gepirone has a molecular weight of 359.50 g/mol, XLogP of 1.80, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for Gepirone is sourced from PubChem (CID 55191), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).