C17H29NO — CID 55192326
2-methyl-N-[[3-(2-methylpentoxy)phenyl]methyl]propan-2-amine (PubChem CID 55192326) has the molecular formula C17H29NO and a molecular weight of 263.43 g/mol. Its IUPAC name is 2-methyl-N-[[3-(2-methylpentoxy)phenyl]methyl]propan-2-amine.
| Compound Name | 2-methyl-N-[[3-(2-methylpentoxy)phenyl]methyl]propan-2-amine |
|---|---|
| PubChem CID | 55192326 |
| Molecular Formula | C17H29NO |
| Molecular Weight | 263.43 g/mol |
| Exact Mass | 263.22 |
| IUPAC Name | 2-methyl-N-[[3-(2-methylpentoxy)phenyl]methyl]propan-2-amine |
| SMILES | CCCC(C)COc1cccc(CNC(C)(C)C)c1 |
| InChI | InChI=1S/C17H29NO/c1-6-8-14(2)13-19-16-10-7-9-15(11-16)12-18-17(3,4)5/h7,9-11,14,18H,6,8,12-13H2,1-5H3 |
| InChIKey | CHZVSNLHTGNKCW-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.43 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |