C14H12BrCl2NO — CID 55193005
2-(3-bromophenyl)-2-(2,4-dichlorophenoxy)ethanamine (PubChem CID 55193005) has the molecular formula C14H12BrCl2NO and a molecular weight of 361.07 g/mol. Its IUPAC name is 2-(3-bromophenyl)-2-(2,4-dichlorophenoxy)ethanamine.
| Compound Name | 2-(3-bromophenyl)-2-(2,4-dichlorophenoxy)ethanamine |
|---|---|
| PubChem CID | 55193005 |
| Molecular Formula | C14H12BrCl2NO |
| Molecular Weight | 361.07 g/mol |
| Exact Mass | 358.95 |
| IUPAC Name | 2-(3-bromophenyl)-2-(2,4-dichlorophenoxy)ethanamine |
| SMILES | NCC(Oc1ccc(Cl)cc1Cl)c1cccc(Br)c1 |
| InChI | InChI=1S/C14H12BrCl2NO/c15-10-3-1-2-9(6-10)14(8-18)19-13-5-4-11(16)7-12(13)17/h1-7,14H,8,18H2 |
| InChIKey | ROENYKRUQORVRR-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.07 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |