C12H22N4O2S — CID 55193232
6-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]-2-methyl-2-(methylamino)hexanoic acid (PubChem CID 55193232) has the molecular formula C12H22N4O2S and a molecular weight of 286.40 g/mol. Its IUPAC name is 6-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]-2-methyl-2-(methylamino)hexanoic acid.
| Compound Name | 6-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]-2-methyl-2-(methylamino)hexanoic acid |
|---|---|
| PubChem CID | 55193232 |
| Molecular Formula | C12H22N4O2S |
| Molecular Weight | 286.40 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | 6-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]-2-methyl-2-(methylamino)hexanoic acid |
| SMILES | CNC(C)(CCCCSc1nnc(C)n1C)C(=O)O |
| InChI | InChI=1S/C12H22N4O2S/c1-9-14-15-11(16(9)4)19-8-6-5-7-12(2,13-3)10(17)18/h13H,5-8H2,1-4H3,(H,17,18) |
| InChIKey | SZKCHIZVAQCJIC-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.40 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|