C11H20N4O2S — CID 55193233
methyl 2-amino-5-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]-2-methylpentanoate (PubChem CID 55193233) has the molecular formula C11H20N4O2S and a molecular weight of 272.37 g/mol. Its IUPAC name is methyl 2-amino-5-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]-2-methylpentanoate.
| Compound Name | methyl 2-amino-5-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]-2-methylpentanoate |
|---|---|
| PubChem CID | 55193233 |
| Molecular Formula | C11H20N4O2S |
| Molecular Weight | 272.37 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | methyl 2-amino-5-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]-2-methylpentanoate |
| SMILES | COC(=O)C(C)(N)CCCSc1nnc(C)n1C |
| InChI | InChI=1S/C11H20N4O2S/c1-8-13-14-10(15(8)3)18-7-5-6-11(2,12)9(16)17-4/h5-7,12H2,1-4H3 |
| InChIKey | UKSSYKFPDIFEPW-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.37 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|