About N-tert-butyl-N',2-dimethyl-N'-(2-methylbutyl)-2-propylpropane-1,3-diamine
N-tert-butyl-N',2-dimethyl-N'-(2-methylbutyl)-2-propylpropane-1,3-diamine (PubChem CID 55194829) has the molecular formula C17H38N2
and a molecular weight of 270.50 g/mol. Its IUPAC name is N-tert-butyl-N',2-dimethyl-N'-(2-methylbutyl)-2-propylpropane-1,3-diamine.
Molecular Properties
| Compound Name | N-tert-butyl-N',2-dimethyl-N'-(2-methylbutyl)-2-propylpropane-1,3-diamine |
| PubChem CID | 55194829 |
| Molecular Formula | C17H38N2 |
| Molecular Weight | 270.50 g/mol |
| Exact Mass | 270.30 |
| IUPAC Name | N-tert-butyl-N',2-dimethyl-N'-(2-methylbutyl)-2-propylpropane-1,3-diamine |
| SMILES | CCCC(C)(CNC(C)(C)C)CN(C)CC(C)CC |
| InChI | InChI=1S/C17H38N2/c1-9-11-17(7,13-18-16(4,5)6)14-19(8)12-15(3)10-2/h15,18H,9-14H2,1-8H3 |
| InChIKey | YKWRQDWFMHIEML-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.50 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-tert-butyl-N',2-dimethyl-N'-(2-methylbutyl)-2-propylpropane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butyl-N',2-dimethyl-N'-(2-methylbutyl)-2-propylpropane-1,3-diamine?
The IUPAC name of N-tert-butyl-N',2-dimethyl-N'-(2-methylbutyl)-2-propylpropane-1,3-diamine (CID 55194829) is N-tert-butyl-N',2-dimethyl-N'-(2-methylbutyl)-2-propylpropane-1,3-diamine.
What is the SMILES notation for N-tert-butyl-N',2-dimethyl-N'-(2-methylbutyl)-2-propylpropane-1,3-diamine?
The canonical SMILES for N-tert-butyl-N',2-dimethyl-N'-(2-methylbutyl)-2-propylpropane-1,3-diamine is CCCC(C)(CNC(C)(C)C)CN(C)CC(C)CC.
What is the InChIKey of N-tert-butyl-N',2-dimethyl-N'-(2-methylbutyl)-2-propylpropane-1,3-diamine?
The InChIKey is YKWRQDWFMHIEML-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H38N2/c1-9-11-17(7,13-18-16(4,5)6)14-19(8)12-15(3)10-2/h15,18H,9-14H2,1-8H3.
What are the key properties of N-tert-butyl-N',2-dimethyl-N'-(2-methylbutyl)-2-propylpropane-1,3-diamine?
N-tert-butyl-N',2-dimethyl-N'-(2-methylbutyl)-2-propylpropane-1,3-diamine has a molecular weight of 270.50 g/mol, XLogP of 4.16, 9 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyl-N',2-dimethyl-N'-(2-methylbutyl)-2-propylpropane-1,3-diamine is sourced from PubChem (CID 55194829), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).