C15H18ClN3 — CID 55195202
(1-chloro-4-methyl-7,8,9,10-tetrahydro-6H-cyclohepta[b]quinolin-11-yl)hydrazine (PubChem CID 55195202) has the molecular formula C15H18ClN3 and a molecular weight of 275.78 g/mol. Its IUPAC name is (1-chloro-4-methyl-7,8,9,10-tetrahydro-6H-cyclohepta[b]quinolin-11-yl)hydrazine.
| Compound Name | (1-chloro-4-methyl-7,8,9,10-tetrahydro-6H-cyclohepta[b]quinolin-11-yl)hydrazine |
|---|---|
| PubChem CID | 55195202 |
| Molecular Formula | C15H18ClN3 |
| Molecular Weight | 275.78 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | (1-chloro-4-methyl-7,8,9,10-tetrahydro-6H-cyclohepta[b]quinolin-11-yl)hydrazine |
| SMILES | Cc1ccc(Cl)c2c(NN)c3c(nc12)CCCCC3 |
| InChI | InChI=1S/C15H18ClN3/c1-9-7-8-11(16)13-14(9)18-12-6-4-2-3-5-10(12)15(13)19-17/h7-8H,2-6,17H2,1H3,(H,18,19) |
| InChIKey | BFZCKSQJINOWSS-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.78 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|