C13H26N4S — CID 55195739
N-[2-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]ethyl]-5-methylhexan-2-amine (PubChem CID 55195739) has the molecular formula C13H26N4S and a molecular weight of 270.45 g/mol. Its IUPAC name is N-[2-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]ethyl]-5-methylhexan-2-amine.
| Compound Name | N-[2-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]ethyl]-5-methylhexan-2-amine |
|---|---|
| PubChem CID | 55195739 |
| Molecular Formula | C13H26N4S |
| Molecular Weight | 270.45 g/mol |
| Exact Mass | 270.19 |
| IUPAC Name | N-[2-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]ethyl]-5-methylhexan-2-amine |
| SMILES | Cc1nnc(SCCNC(C)CCC(C)C)n1C |
| InChI | InChI=1S/C13H26N4S/c1-10(2)6-7-11(3)14-8-9-18-13-16-15-12(4)17(13)5/h10-11,14H,6-9H2,1-5H3 |
| InChIKey | WDVLXTYEYLTXFK-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.45 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|