C13H24N4S — CID 55196499
N-(cyclohexylmethyl)-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]ethanamine (PubChem CID 55196499) has the molecular formula C13H24N4S and a molecular weight of 268.43 g/mol. Its IUPAC name is N-(cyclohexylmethyl)-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]ethanamine.
| Compound Name | N-(cyclohexylmethyl)-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]ethanamine |
|---|---|
| PubChem CID | 55196499 |
| Molecular Formula | C13H24N4S |
| Molecular Weight | 268.43 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | N-(cyclohexylmethyl)-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]ethanamine |
| SMILES | Cc1nnc(SCCNCC2CCCCC2)n1C |
| InChI | InChI=1S/C13H24N4S/c1-11-15-16-13(17(11)2)18-9-8-14-10-12-6-4-3-5-7-12/h12,14H,3-10H2,1-2H3 |
| InChIKey | PXYFNGPBCKIYAN-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.43 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|