C15H12Cl2O — CID 55196773
1-(2,4-dichlorophenyl)-2-(2-methylphenyl)ethanone (PubChem CID 55196773) has the molecular formula C15H12Cl2O and a molecular weight of 279.17 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-2-(2-methylphenyl)ethanone.
| Compound Name | 1-(2,4-dichlorophenyl)-2-(2-methylphenyl)ethanone |
|---|---|
| PubChem CID | 55196773 |
| Molecular Formula | C15H12Cl2O |
| Molecular Weight | 279.17 g/mol |
| Exact Mass | 278.03 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-2-(2-methylphenyl)ethanone |
| SMILES | Cc1ccccc1CC(=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C15H12Cl2O/c1-10-4-2-3-5-11(10)8-15(18)13-7-6-12(16)9-14(13)17/h2-7,9H,8H2,1H3 |
| InChIKey | GITDASVPXMOFNN-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.17 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |