C17H25ClO — CID 55198813
5-(1-chloro-3,5,5-trimethylhexyl)-1,3-dihydro-2-benzofuran (PubChem CID 55198813) has the molecular formula C17H25ClO and a molecular weight of 280.84 g/mol. Its IUPAC name is 5-(1-chloro-3,5,5-trimethylhexyl)-1,3-dihydro-2-benzofuran.
| Compound Name | 5-(1-chloro-3,5,5-trimethylhexyl)-1,3-dihydro-2-benzofuran |
|---|---|
| PubChem CID | 55198813 |
| Molecular Formula | C17H25ClO |
| Molecular Weight | 280.84 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | 5-(1-chloro-3,5,5-trimethylhexyl)-1,3-dihydro-2-benzofuran |
| SMILES | CC(CC(Cl)c1ccc2c(c1)COC2)CC(C)(C)C |
| InChI | InChI=1S/C17H25ClO/c1-12(9-17(2,3)4)7-16(18)13-5-6-14-10-19-11-15(14)8-13/h5-6,8,12,16H,7,9-11H2,1-4H3 |
| InChIKey | QFIWGTDQTOENHO-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.84 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|