About 2,5-dibromo-3-[chloro-(2,4-difluorophenyl)methyl]thiophene
2,5-dibromo-3-[chloro-(2,4-difluorophenyl)methyl]thiophene (PubChem CID 55199104) has the molecular formula C11H5Br2ClF2S
and a molecular weight of 402.49 g/mol. Its IUPAC name is 2,5-dibromo-3-[chloro-(2,4-difluorophenyl)methyl]thiophene.
Molecular Properties
| Compound Name | 2,5-dibromo-3-[chloro-(2,4-difluorophenyl)methyl]thiophene |
| PubChem CID | 55199104 |
| Molecular Formula | C11H5Br2ClF2S |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 399.81 |
| IUPAC Name | 2,5-dibromo-3-[chloro-(2,4-difluorophenyl)methyl]thiophene |
| SMILES | Fc1ccc(C(Cl)c2cc(Br)sc2Br)c(F)c1 |
| InChI | InChI=1S/C11H5Br2ClF2S/c12-9-4-7(11(13)17-9)10(14)6-2-1-5(15)3-8(6)16/h1-4,10H |
| InChIKey | HLRYPSVMJLKWOE-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2,5-dibromo-3-[chloro-(2,4-difluorophenyl)methyl]thiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dibromo-3-[chloro-(2,4-difluorophenyl)methyl]thiophene?
The IUPAC name of 2,5-dibromo-3-[chloro-(2,4-difluorophenyl)methyl]thiophene (CID 55199104) is 2,5-dibromo-3-[chloro-(2,4-difluorophenyl)methyl]thiophene.
What is the SMILES notation for 2,5-dibromo-3-[chloro-(2,4-difluorophenyl)methyl]thiophene?
The canonical SMILES for 2,5-dibromo-3-[chloro-(2,4-difluorophenyl)methyl]thiophene is Fc1ccc(C(Cl)c2cc(Br)sc2Br)c(F)c1.
What is the InChIKey of 2,5-dibromo-3-[chloro-(2,4-difluorophenyl)methyl]thiophene?
The InChIKey is HLRYPSVMJLKWOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H5Br2ClF2S/c12-9-4-7(11(13)17-9)10(14)6-2-1-5(15)3-8(6)16/h1-4,10H.
What are the key properties of 2,5-dibromo-3-[chloro-(2,4-difluorophenyl)methyl]thiophene?
2,5-dibromo-3-[chloro-(2,4-difluorophenyl)methyl]thiophene has a molecular weight of 402.49 g/mol, XLogP of 5.88, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dibromo-3-[chloro-(2,4-difluorophenyl)methyl]thiophene is sourced from PubChem (CID 55199104), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).