About 3-[(5-bromo-2-fluorophenyl)-chloromethyl]-2,5-dimethylthiophene
3-[(5-bromo-2-fluorophenyl)-chloromethyl]-2,5-dimethylthiophene (PubChem CID 55200047) has the molecular formula C13H11BrClFS
and a molecular weight of 333.65 g/mol. Its IUPAC name is 3-[(5-bromo-2-fluorophenyl)-chloromethyl]-2,5-dimethylthiophene.
Molecular Properties
| Compound Name | 3-[(5-bromo-2-fluorophenyl)-chloromethyl]-2,5-dimethylthiophene |
| PubChem CID | 55200047 |
| Molecular Formula | C13H11BrClFS |
| Molecular Weight | 333.65 g/mol |
| Exact Mass | 331.94 |
| IUPAC Name | 3-[(5-bromo-2-fluorophenyl)-chloromethyl]-2,5-dimethylthiophene |
| SMILES | Cc1cc(C(Cl)c2cc(Br)ccc2F)c(C)s1 |
| InChI | InChI=1S/C13H11BrClFS/c1-7-5-10(8(2)17-7)13(15)11-6-9(14)3-4-12(11)16/h3-6,13H,1-2H3 |
| InChIKey | BFYWMIDLOCFNIV-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 333.65 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-[(5-bromo-2-fluorophenyl)-chloromethyl]-2,5-dimethylthiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(5-bromo-2-fluorophenyl)-chloromethyl]-2,5-dimethylthiophene?
The IUPAC name of 3-[(5-bromo-2-fluorophenyl)-chloromethyl]-2,5-dimethylthiophene (CID 55200047) is 3-[(5-bromo-2-fluorophenyl)-chloromethyl]-2,5-dimethylthiophene.
What is the SMILES notation for 3-[(5-bromo-2-fluorophenyl)-chloromethyl]-2,5-dimethylthiophene?
The canonical SMILES for 3-[(5-bromo-2-fluorophenyl)-chloromethyl]-2,5-dimethylthiophene is Cc1cc(C(Cl)c2cc(Br)ccc2F)c(C)s1.
What is the InChIKey of 3-[(5-bromo-2-fluorophenyl)-chloromethyl]-2,5-dimethylthiophene?
The InChIKey is BFYWMIDLOCFNIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11BrClFS/c1-7-5-10(8(2)17-7)13(15)11-6-9(14)3-4-12(11)16/h3-6,13H,1-2H3.
What are the key properties of 3-[(5-bromo-2-fluorophenyl)-chloromethyl]-2,5-dimethylthiophene?
3-[(5-bromo-2-fluorophenyl)-chloromethyl]-2,5-dimethylthiophene has a molecular weight of 333.65 g/mol, XLogP of 5.59, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(5-bromo-2-fluorophenyl)-chloromethyl]-2,5-dimethylthiophene is sourced from PubChem (CID 55200047), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).