C11H16ClN7O — CID 552007
2-[[4-chloro-6-(dimethylamino)-1,3,5-triazin-2-yl]-cyanoamino]-N,N-dimethylpropanamide (PubChem CID 552007) has the molecular formula C11H16ClN7O and a molecular weight of 297.75 g/mol. Its IUPAC name is 2-[[4-chloro-6-(dimethylamino)-1,3,5-triazin-2-yl]-cyanoamino]-N,N-dimethylpropanamide.
| Compound Name | 2-[[4-chloro-6-(dimethylamino)-1,3,5-triazin-2-yl]-cyanoamino]-N,N-dimethylpropanamide |
|---|---|
| PubChem CID | 552007 |
| Molecular Formula | C11H16ClN7O |
| Molecular Weight | 297.75 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | 2-[[4-chloro-6-(dimethylamino)-1,3,5-triazin-2-yl]-cyanoamino]-N,N-dimethylpropanamide |
| SMILES | CC(C(=O)N(C)C)N(C#N)c1nc(Cl)nc(N(C)C)n1 |
| InChI | InChI=1S/C11H16ClN7O/c1-7(8(20)17(2)3)19(6-13)11-15-9(12)14-10(16-11)18(4)5/h7H,1-5H3 |
| InChIKey | ZATHRJFXFHPFLZ-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 89.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.75 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|