C13H14N2O3 — CID 55201236
4-[3-(2-methoxyphenyl)-1,2,4-oxadiazol-5-yl]butan-2-one (PubChem CID 55201236) has the molecular formula C13H14N2O3 and a molecular weight of 246.27 g/mol. Its IUPAC name is 4-[3-(2-methoxyphenyl)-1,2,4-oxadiazol-5-yl]butan-2-one.
| Compound Name | 4-[3-(2-methoxyphenyl)-1,2,4-oxadiazol-5-yl]butan-2-one |
|---|---|
| PubChem CID | 55201236 |
| Molecular Formula | C13H14N2O3 |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | 4-[3-(2-methoxyphenyl)-1,2,4-oxadiazol-5-yl]butan-2-one |
| SMILES | COc1ccccc1-c1noc(CCC(C)=O)n1 |
| InChI | InChI=1S/C13H14N2O3/c1-9(16)7-8-12-14-13(15-18-12)10-5-3-4-6-11(10)17-2/h3-6H,7-8H2,1-2H3 |
| InChIKey | OAOHJCAHHVZSPU-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |