C7H6F6N2O2 — CID 55201449
1,1,1-trifluoro-3-[3-(2,2,2-trifluoroethyl)-1,2,4-oxadiazol-5-yl]propan-2-ol (PubChem CID 55201449) has the molecular formula C7H6F6N2O2 and a molecular weight of 264.12 g/mol. Its IUPAC name is 1,1,1-trifluoro-3-[3-(2,2,2-trifluoroethyl)-1,2,4-oxadiazol-5-yl]propan-2-ol.
| Compound Name | 1,1,1-trifluoro-3-[3-(2,2,2-trifluoroethyl)-1,2,4-oxadiazol-5-yl]propan-2-ol |
|---|---|
| PubChem CID | 55201449 |
| Molecular Formula | C7H6F6N2O2 |
| Molecular Weight | 264.12 g/mol |
| Exact Mass | 264.03 |
| IUPAC Name | 1,1,1-trifluoro-3-[3-(2,2,2-trifluoroethyl)-1,2,4-oxadiazol-5-yl]propan-2-ol |
| SMILES | OC(Cc1nc(CC(F)(F)F)no1)C(F)(F)F |
| InChI | InChI=1S/C7H6F6N2O2/c8-6(9,10)2-4-14-5(17-15-4)1-3(16)7(11,12)13/h3,16H,1-2H2 |
| InChIKey | OTELHIRPKBMCOD-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 59.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.12 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |