About 3-[(2-amino-6-fluorophenyl)methylsulfanyl]-4-propan-2-yl-1H-1,2,4-triazol-5-one
3-[(2-amino-6-fluorophenyl)methylsulfanyl]-4-propan-2-yl-1H-1,2,4-triazol-5-one (PubChem CID 55201731) has the molecular formula C12H15FN4OS
and a molecular weight of 282.34 g/mol. Its IUPAC name is 3-[(2-amino-6-fluorophenyl)methylsulfanyl]-4-propan-2-yl-1H-1,2,4-triazol-5-one.
Molecular Properties
| Compound Name | 3-[(2-amino-6-fluorophenyl)methylsulfanyl]-4-propan-2-yl-1H-1,2,4-triazol-5-one |
| PubChem CID | 55201731 |
| Molecular Formula | C12H15FN4OS |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | 3-[(2-amino-6-fluorophenyl)methylsulfanyl]-4-propan-2-yl-1H-1,2,4-triazol-5-one |
| SMILES | CC(C)n1c(SCc2c(N)cccc2F)n[nH]c1=O |
| InChI | InChI=1S/C12H15FN4OS/c1-7(2)17-11(18)15-16-12(17)19-6-8-9(13)4-3-5-10(8)14/h3-5,7H,6,14H2,1-2H3,(H,15,18) |
| InChIKey | HVSRWPYWCJPSMC-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 76.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-[(2-amino-6-fluorophenyl)methylsulfanyl]-4-propan-2-yl-1H-1,2,4-triazol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2-amino-6-fluorophenyl)methylsulfanyl]-4-propan-2-yl-1H-1,2,4-triazol-5-one?
The IUPAC name of 3-[(2-amino-6-fluorophenyl)methylsulfanyl]-4-propan-2-yl-1H-1,2,4-triazol-5-one (CID 55201731) is 3-[(2-amino-6-fluorophenyl)methylsulfanyl]-4-propan-2-yl-1H-1,2,4-triazol-5-one.
What is the SMILES notation for 3-[(2-amino-6-fluorophenyl)methylsulfanyl]-4-propan-2-yl-1H-1,2,4-triazol-5-one?
The canonical SMILES for 3-[(2-amino-6-fluorophenyl)methylsulfanyl]-4-propan-2-yl-1H-1,2,4-triazol-5-one is CC(C)n1c(SCc2c(N)cccc2F)n[nH]c1=O.
What is the InChIKey of 3-[(2-amino-6-fluorophenyl)methylsulfanyl]-4-propan-2-yl-1H-1,2,4-triazol-5-one?
The InChIKey is HVSRWPYWCJPSMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15FN4OS/c1-7(2)17-11(18)15-16-12(17)19-6-8-9(13)4-3-5-10(8)14/h3-5,7H,6,14H2,1-2H3,(H,15,18).
What are the key properties of 3-[(2-amino-6-fluorophenyl)methylsulfanyl]-4-propan-2-yl-1H-1,2,4-triazol-5-one?
3-[(2-amino-6-fluorophenyl)methylsulfanyl]-4-propan-2-yl-1H-1,2,4-triazol-5-one has a molecular weight of 282.34 g/mol, XLogP of 2.17, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2-amino-6-fluorophenyl)methylsulfanyl]-4-propan-2-yl-1H-1,2,4-triazol-5-one is sourced from PubChem (CID 55201731), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).