C12H14N2O3 — CID 55202211
2-[3-(methoxymethyl)-1,2,4-oxadiazol-5-yl]-1-phenylethanol (PubChem CID 55202211) has the molecular formula C12H14N2O3 and a molecular weight of 234.25 g/mol. Its IUPAC name is 2-[3-(methoxymethyl)-1,2,4-oxadiazol-5-yl]-1-phenylethanol.
| Compound Name | 2-[3-(methoxymethyl)-1,2,4-oxadiazol-5-yl]-1-phenylethanol |
|---|---|
| PubChem CID | 55202211 |
| Molecular Formula | C12H14N2O3 |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.10 |
| IUPAC Name | 2-[3-(methoxymethyl)-1,2,4-oxadiazol-5-yl]-1-phenylethanol |
| SMILES | COCc1noc(CC(O)c2ccccc2)n1 |
| InChI | InChI=1S/C12H14N2O3/c1-16-8-11-13-12(17-14-11)7-10(15)9-5-3-2-4-6-9/h2-6,10,15H,7-8H2,1H3 |
| InChIKey | WGHJUKZLRNQARM-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 68.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |