About N-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]octan-1-amine
N-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]octan-1-amine (PubChem CID 55202476) has the molecular formula C13H26N4
and a molecular weight of 238.38 g/mol. Its IUPAC name is N-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]octan-1-amine.
Molecular Properties
| Compound Name | N-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]octan-1-amine |
| PubChem CID | 55202476 |
| Molecular Formula | C13H26N4 |
| Molecular Weight | 238.38 g/mol |
| Exact Mass | 238.22 |
| IUPAC Name | N-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]octan-1-amine |
| SMILES | CCCCCCCCNCCc1nncn1C |
| InChI | InChI=1S/C13H26N4/c1-3-4-5-6-7-8-10-14-11-9-13-16-15-12-17(13)2/h12,14H,3-11H2,1-2H3 |
| InChIKey | DNRIMZNLXYTKLE-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.38 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]octan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]octan-1-amine?
The IUPAC name of N-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]octan-1-amine (CID 55202476) is N-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]octan-1-amine.
What is the SMILES notation for N-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]octan-1-amine?
The canonical SMILES for N-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]octan-1-amine is CCCCCCCCNCCc1nncn1C.
What is the InChIKey of N-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]octan-1-amine?
The InChIKey is DNRIMZNLXYTKLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26N4/c1-3-4-5-6-7-8-10-14-11-9-13-16-15-12-17(13)2/h12,14H,3-11H2,1-2H3.
What are the key properties of N-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]octan-1-amine?
N-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]octan-1-amine has a molecular weight of 238.38 g/mol, XLogP of 2.31, 10 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(4-methyl-1,2,4-triazol-3-yl)ethyl]octan-1-amine is sourced from PubChem (CID 55202476), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).