C15H25NO2 — CID 55204167
5-[2-(ethylaminomethyl)-4-methylphenoxy]pentan-1-ol (PubChem CID 55204167) has the molecular formula C15H25NO2 and a molecular weight of 251.37 g/mol. Its IUPAC name is 5-[2-(ethylaminomethyl)-4-methylphenoxy]pentan-1-ol.
| Compound Name | 5-[2-(ethylaminomethyl)-4-methylphenoxy]pentan-1-ol |
|---|---|
| PubChem CID | 55204167 |
| Molecular Formula | C15H25NO2 |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.19 |
| IUPAC Name | 5-[2-(ethylaminomethyl)-4-methylphenoxy]pentan-1-ol |
| SMILES | CCNCc1cc(C)ccc1OCCCCCO |
| InChI | InChI=1S/C15H25NO2/c1-3-16-12-14-11-13(2)7-8-15(14)18-10-6-4-5-9-17/h7-8,11,16-17H,3-6,9-10,12H2,1-2H3 |
| InChIKey | NSWJZHDVVUKOMV-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|