C14H13NO4 — CID 55204890
5-[(2,3-dihydro-1-benzofuran-5-ylamino)methyl]furan-2-carboxylic acid (PubChem CID 55204890) has the molecular formula C14H13NO4 and a molecular weight of 259.26 g/mol. Its IUPAC name is 5-[(2,3-dihydro-1-benzofuran-5-ylamino)methyl]furan-2-carboxylic acid.
| Compound Name | 5-[(2,3-dihydro-1-benzofuran-5-ylamino)methyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 55204890 |
| Molecular Formula | C14H13NO4 |
| Molecular Weight | 259.26 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | 5-[(2,3-dihydro-1-benzofuran-5-ylamino)methyl]furan-2-carboxylic acid |
| SMILES | O=C(O)c1ccc(CNc2ccc3c(c2)CCO3)o1 |
| InChI | InChI=1S/C14H13NO4/c16-14(17)13-4-2-11(19-13)8-15-10-1-3-12-9(7-10)5-6-18-12/h1-4,7,15H,5-6,8H2,(H,16,17) |
| InChIKey | PXZARTDFSBXJQU-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 71.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.26 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|