C14H20Cl2N2 — CID 55204961
N-[(2,6-dichlorophenyl)methyl]-N-propylpyrrolidin-3-amine (PubChem CID 55204961) has the molecular formula C14H20Cl2N2 and a molecular weight of 287.23 g/mol. Its IUPAC name is N-[(2,6-dichlorophenyl)methyl]-N-propylpyrrolidin-3-amine.
| Compound Name | N-[(2,6-dichlorophenyl)methyl]-N-propylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 55204961 |
| Molecular Formula | C14H20Cl2N2 |
| Molecular Weight | 287.23 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | N-[(2,6-dichlorophenyl)methyl]-N-propylpyrrolidin-3-amine |
| SMILES | CCCN(Cc1c(Cl)cccc1Cl)C1CCNC1 |
| InChI | InChI=1S/C14H20Cl2N2/c1-2-8-18(11-6-7-17-9-11)10-12-13(15)4-3-5-14(12)16/h3-5,11,17H,2,6-10H2,1H3 |
| InChIKey | VYAFIRLQGCBIEB-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.23 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |