C9H10FN5O2S — CID 55205304
3-amino-5-fluoro-N-(1H-1,2,4-triazol-5-ylmethyl)benzenesulfonamide (PubChem CID 55205304) has the molecular formula C9H10FN5O2S and a molecular weight of 271.28 g/mol. Its IUPAC name is 3-amino-5-fluoro-N-(1H-1,2,4-triazol-5-ylmethyl)benzenesulfonamide.
| Compound Name | 3-amino-5-fluoro-N-(1H-1,2,4-triazol-5-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 55205304 |
| Molecular Formula | C9H10FN5O2S |
| Molecular Weight | 271.28 g/mol |
| Exact Mass | 271.05 |
| IUPAC Name | 3-amino-5-fluoro-N-(1H-1,2,4-triazol-5-ylmethyl)benzenesulfonamide |
| SMILES | Nc1cc(F)cc(S(=O)(=O)NCc2ncn[nH]2)c1 |
| InChI | InChI=1S/C9H10FN5O2S/c10-6-1-7(11)3-8(2-6)18(16,17)14-4-9-12-5-13-15-9/h1-3,5,14H,4,11H2,(H,12,13,15) |
| InChIKey | YWGFJVSEMPVLHF-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 113.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.28 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|