C9H15F3N4OS — CID 55206204
[4-ethyl-5-[2-(2,2,2-trifluoroethoxy)ethylsulfanyl]-1,2,4-triazol-3-yl]methanamine (PubChem CID 55206204) has the molecular formula C9H15F3N4OS and a molecular weight of 284.31 g/mol. Its IUPAC name is [4-ethyl-5-[2-(2,2,2-trifluoroethoxy)ethylsulfanyl]-1,2,4-triazol-3-yl]methanamine.
| Compound Name | [4-ethyl-5-[2-(2,2,2-trifluoroethoxy)ethylsulfanyl]-1,2,4-triazol-3-yl]methanamine |
|---|---|
| PubChem CID | 55206204 |
| Molecular Formula | C9H15F3N4OS |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.09 |
| IUPAC Name | [4-ethyl-5-[2-(2,2,2-trifluoroethoxy)ethylsulfanyl]-1,2,4-triazol-3-yl]methanamine |
| SMILES | CCn1c(CN)nnc1SCCOCC(F)(F)F |
| InChI | InChI=1S/C9H15F3N4OS/c1-2-16-7(5-13)14-15-8(16)18-4-3-17-6-9(10,11)12/h2-6,13H2,1H3 |
| InChIKey | VJKLBVRMQFDAGW-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|