C12H18N2O3S — CID 55206379
N-[[3-(hydroxymethyl)phenyl]methyl]pyrrolidine-1-sulfonamide (PubChem CID 55206379) has the molecular formula C12H18N2O3S and a molecular weight of 270.35 g/mol. Its IUPAC name is N-[[3-(hydroxymethyl)phenyl]methyl]pyrrolidine-1-sulfonamide.
| Compound Name | N-[[3-(hydroxymethyl)phenyl]methyl]pyrrolidine-1-sulfonamide |
|---|---|
| PubChem CID | 55206379 |
| Molecular Formula | C12H18N2O3S |
| Molecular Weight | 270.35 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | N-[[3-(hydroxymethyl)phenyl]methyl]pyrrolidine-1-sulfonamide |
| SMILES | O=S(=O)(NCc1cccc(CO)c1)N1CCCC1 |
| InChI | InChI=1S/C12H18N2O3S/c15-10-12-5-3-4-11(8-12)9-13-18(16,17)14-6-1-2-7-14/h3-5,8,13,15H,1-2,6-7,9-10H2 |
| InChIKey | MUYJWCQZAYVQKP-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.35 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |