About 1-cyano-N,N-bis(2-methylpropyl)methanesulfonamide
1-cyano-N,N-bis(2-methylpropyl)methanesulfonamide (PubChem CID 55206618) has the molecular formula C10H20N2O2S
and a molecular weight of 232.35 g/mol. Its IUPAC name is 1-cyano-N,N-bis(2-methylpropyl)methanesulfonamide.
Molecular Properties
| Compound Name | 1-cyano-N,N-bis(2-methylpropyl)methanesulfonamide |
| PubChem CID | 55206618 |
| Molecular Formula | C10H20N2O2S |
| Molecular Weight | 232.35 g/mol |
| Exact Mass | 232.12 |
| IUPAC Name | 1-cyano-N,N-bis(2-methylpropyl)methanesulfonamide |
| SMILES | CC(C)CN(CC(C)C)S(=O)(=O)CC#N |
| InChI | InChI=1S/C10H20N2O2S/c1-9(2)7-12(8-10(3)4)15(13,14)6-5-11/h9-10H,6-8H2,1-4H3 |
| InChIKey | VHHGVQICFPYWKL-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.35 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-cyano-N,N-bis(2-methylpropyl)methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyano-N,N-bis(2-methylpropyl)methanesulfonamide?
The IUPAC name of 1-cyano-N,N-bis(2-methylpropyl)methanesulfonamide (CID 55206618) is 1-cyano-N,N-bis(2-methylpropyl)methanesulfonamide.
What is the SMILES notation for 1-cyano-N,N-bis(2-methylpropyl)methanesulfonamide?
The canonical SMILES for 1-cyano-N,N-bis(2-methylpropyl)methanesulfonamide is CC(C)CN(CC(C)C)S(=O)(=O)CC#N.
What is the InChIKey of 1-cyano-N,N-bis(2-methylpropyl)methanesulfonamide?
The InChIKey is VHHGVQICFPYWKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N2O2S/c1-9(2)7-12(8-10(3)4)15(13,14)6-5-11/h9-10H,6-8H2,1-4H3.
What are the key properties of 1-cyano-N,N-bis(2-methylpropyl)methanesulfonamide?
1-cyano-N,N-bis(2-methylpropyl)methanesulfonamide has a molecular weight of 232.35 g/mol, XLogP of 1.45, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyano-N,N-bis(2-methylpropyl)methanesulfonamide is sourced from PubChem (CID 55206618), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).