About 3-[propan-2-yl(2,2,2-trifluoroethyl)amino]pentanenitrile
3-[propan-2-yl(2,2,2-trifluoroethyl)amino]pentanenitrile (PubChem CID 55206840) has the molecular formula C10H17F3N2
and a molecular weight of 222.25 g/mol. Its IUPAC name is 3-[propan-2-yl(2,2,2-trifluoroethyl)amino]pentanenitrile.
Molecular Properties
| Compound Name | 3-[propan-2-yl(2,2,2-trifluoroethyl)amino]pentanenitrile |
| PubChem CID | 55206840 |
| Molecular Formula | C10H17F3N2 |
| Molecular Weight | 222.25 g/mol |
| Exact Mass | 222.13 |
| IUPAC Name | 3-[propan-2-yl(2,2,2-trifluoroethyl)amino]pentanenitrile |
| SMILES | CCC(CC#N)N(CC(F)(F)F)C(C)C |
| InChI | InChI=1S/C10H17F3N2/c1-4-9(5-6-14)15(8(2)3)7-10(11,12)13/h8-9H,4-5,7H2,1-3H3 |
| InChIKey | GPZJMNYCRUXSPX-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.25 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-[propan-2-yl(2,2,2-trifluoroethyl)amino]pentanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[propan-2-yl(2,2,2-trifluoroethyl)amino]pentanenitrile?
The IUPAC name of 3-[propan-2-yl(2,2,2-trifluoroethyl)amino]pentanenitrile (CID 55206840) is 3-[propan-2-yl(2,2,2-trifluoroethyl)amino]pentanenitrile.
What is the SMILES notation for 3-[propan-2-yl(2,2,2-trifluoroethyl)amino]pentanenitrile?
The canonical SMILES for 3-[propan-2-yl(2,2,2-trifluoroethyl)amino]pentanenitrile is CCC(CC#N)N(CC(F)(F)F)C(C)C.
What is the InChIKey of 3-[propan-2-yl(2,2,2-trifluoroethyl)amino]pentanenitrile?
The InChIKey is GPZJMNYCRUXSPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17F3N2/c1-4-9(5-6-14)15(8(2)3)7-10(11,12)13/h8-9H,4-5,7H2,1-3H3.
What are the key properties of 3-[propan-2-yl(2,2,2-trifluoroethyl)amino]pentanenitrile?
3-[propan-2-yl(2,2,2-trifluoroethyl)amino]pentanenitrile has a molecular weight of 222.25 g/mol, XLogP of 2.95, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[propan-2-yl(2,2,2-trifluoroethyl)amino]pentanenitrile is sourced from PubChem (CID 55206840), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).