C13H22N2 — CID 55207107
2-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)butanenitrile (PubChem CID 55207107) has the molecular formula C13H22N2 and a molecular weight of 206.33 g/mol. Its IUPAC name is 2-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)butanenitrile.
| Compound Name | 2-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)butanenitrile |
|---|---|
| PubChem CID | 55207107 |
| Molecular Formula | C13H22N2 |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.18 |
| IUPAC Name | 2-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)butanenitrile |
| SMILES | CCC(C#N)N1CCCC2CCCCC21 |
| InChI | InChI=1S/C13H22N2/c1-2-12(10-14)15-9-5-7-11-6-3-4-8-13(11)15/h11-13H,2-9H2,1H3 |
| InChIKey | IRARFCQRYAWHNR-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |