C12H15NO3 — CID 55207727
2-(3,5-dimethoxyphenoxy)butanenitrile (PubChem CID 55207727) has the molecular formula C12H15NO3 and a molecular weight of 221.26 g/mol. Its IUPAC name is 2-(3,5-dimethoxyphenoxy)butanenitrile.
| Compound Name | 2-(3,5-dimethoxyphenoxy)butanenitrile |
|---|---|
| PubChem CID | 55207727 |
| Molecular Formula | C12H15NO3 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.11 |
| IUPAC Name | 2-(3,5-dimethoxyphenoxy)butanenitrile |
| SMILES | CCC(C#N)Oc1cc(OC)cc(OC)c1 |
| InChI | InChI=1S/C12H15NO3/c1-4-9(8-13)16-12-6-10(14-2)5-11(7-12)15-3/h5-7,9H,4H2,1-3H3 |
| InChIKey | YZRJSNLOJXRUFH-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 51.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |