C10H14N4O — CID 55208289
2-cyano-N-(1-methylpyrazol-3-yl)pentanamide (PubChem CID 55208289) has the molecular formula C10H14N4O and a molecular weight of 206.25 g/mol. Its IUPAC name is 2-cyano-N-(1-methylpyrazol-3-yl)pentanamide.
| Compound Name | 2-cyano-N-(1-methylpyrazol-3-yl)pentanamide |
|---|---|
| PubChem CID | 55208289 |
| Molecular Formula | C10H14N4O |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.12 |
| IUPAC Name | 2-cyano-N-(1-methylpyrazol-3-yl)pentanamide |
| SMILES | CCCC(C#N)C(=O)Nc1ccn(C)n1 |
| InChI | InChI=1S/C10H14N4O/c1-3-4-8(7-11)10(15)12-9-5-6-14(2)13-9/h5-6,8H,3-4H2,1-2H3,(H,12,13,15) |
| InChIKey | CEJZPOVWMMLXCK-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 70.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |